Aryl chlorides
Aobchem 4-Bromo-2 3-dichlorotoluene | ≥95% | CAS 1807029-15-7 | C7H5BrCl2 | 5g
4-Bromo-2 3-dichlorotoluene | ≥95% | CAS 1807029-15-7 | C7H5BrCl2 | 5g
Aobchem 4 5-Dichlorobenzene-1 2-diol | ≥97% | CAS 3428-24-8 | C6H4Cl2O2 | 1g
4 5-Dichlorobenzene-1 2-diol | ≥97% | CAS 3428-24-8 | C6H4Cl2O2 | 1g
Aobchem 5-Bromo-2 4-dichlorotoluene | ≥97% | CAS 85072-41-9 | C7H5BrCl2 | 500mg
5-Bromo-2 4-dichlorotoluene | ≥97% | CAS 85072-41-9 | C7H5BrCl2 | 500mg
Aobchem 1-Benzyl-3 5-dichlorobenzene | 97% | C13H10Cl2 | 1g
1-Benzyl-3 5-dichlorobenzene | 97% | C13H10Cl2 | 1g
Aobchem 1-Benzyl-3 5-dichlorobenzene | 97% | C13H10Cl2 | 5g
1-Benzyl-3 5-dichlorobenzene | 97% | C13H10Cl2 | 5g
eMolecules 129960-45-8 | 2-(3,5-Dichlorophenyl)propan-2-amine | MFCD11846158 | 1g
AstaTech | TETRAKIS(TRIPHENYLPHOSPHINE)NICKEL | 0.25g | 718062354 | D82226 | 95.000 | 15133-82-1 | MFCD00010011 | 1107.860 | C72H60NiP4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 16606-61-4 | 2,4-Dichlorobenzene-1,3-diol | MFCD13152136 | 1g
Ambeed | 26-Di-tert-butyl-4-methylcyclohexanone | 250mg | 596567893 | A117602 | 23790-39-8 | MFCD27976821 | 224.388 | C15H28O
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 179051-78-6 | 4-Chloropyrimidine hydrochloride | MFCD11870807 | 1g
Medchem Express | FGFR2-IN-2 | 5mg | 719836073 | HY-145231 | 2677709-81-6 | 370.456 | C23H22N4O
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 287176-62-9 | 6-Bromo-2-chloroquinoline-4-carboxylic acid | MFCD00106420 | 1g
Medchem Express | Tocainide (hydrochloride) | 5mg | 752823349 | HY-B1798A | 71395-14-7 | MFCD00941502 | 228.720 | C11H17ClN2O
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
![eMolecules 15965-31-8 | 4-Chloroimidazole | Combi-Blocks | MFCD09033087 | 102.520 | C3H3ClN2 | 97.000 | Clc1c[nH]cn1 | 1g | 205405546](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502187743.JPG-250.jpg)
eMolecules 15965-31-8 | 4-Chloroimidazole | Combi-Blocks | MFCD09033087 | 102.520 | C3H3ClN2 | 97.000 | Clc1c[nH]cn1 | 1g | 205405546
4-Chloroimidazole | Combi-Blocks | 15965-31-8 | MFCD09033087 | 102.520 | C3H3ClN2 | 97.000 | Clc1c[nH]cn1 | 1g | 205405546
eMolecules 129822-48-6 | 1-Boc-5-chloroindole | Combi-Blocks | MFCD05865201 | 251.710 | C13H14ClNO2 | 98.000 | CC(C)(C)OC(=O)n1ccc2cc(Cl)ccc12 | 1g | 117535393
1-Boc-5-chloroindole | Combi-Blocks | 129822-48-6 | MFCD05865201 | 251.710 | C13H14ClNO2 | 98.000 | CC(C)(C)OC(=O)n1ccc2cc(Cl)ccc12 | 1g | 117535393
Chem-Impex International, Inc. 4-Chloroquinoline | MFCD00006773 | 5G
4-Chloroquinoline, MFCD00006773, 5G
Chem-Impex International, Inc. 5-Chloro-2-cyanopyridine | MFCD03788835 | 25G
5-Chloro-2-cyanopyridine, MFCD03788835, 25G
Sigma Aldrich Fine Chemicals Biosciences 1,2-Dichlorobenzene ReagentPlus(R), 99% | 95-50-1 | MFCD00000535 | 100ML
1,2-Dichlorobenzene ReagentPlus(R), 99% | Purity: 99% | Mol Wt: 147 | 95-50-1 | MFCD00000535 | 100ML
Chem-Impex International, Inc. 4-Chloroquinoline | MFCD00006773 | 1G
4-Chloroquinoline, MFCD00006773, 1G